C33H45Cl2N4O4+ — CID 87699357
[2-[[2-(3,4-dichlorophenyl)-4-[1-[4-(dimethylcarbamoyl)piperidin-4-yl]piperidin-1-ium-1-yl]butyl]-methylcarbamoyl]phenyl] acetate (PubChem CID 87699357) has the molecular formula C33H45Cl2N4O4+ and a molecular weight of 632.65 g/mol. Its IUPAC name is [2-[[2-(3,4-dichlorophenyl)-4-[1-[4-(dimethylcarbamoyl)piperidin-4-yl]piperidin-1-ium-1-yl]butyl]-methylcarbamoyl]phenyl] acetate.
| Compound Name | [2-[[2-(3,4-dichlorophenyl)-4-[1-[4-(dimethylcarbamoyl)piperidin-4-yl]piperidin-1-ium-1-yl]butyl]-methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 87699357 |
| Molecular Formula | C33H45Cl2N4O4+ |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | [2-[[2-(3,4-dichlorophenyl)-4-[1-[4-(dimethylcarbamoyl)piperidin-4-yl]piperidin-1-ium-1-yl]butyl]-methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)N(C)CC(CC[N+]1(C2(C(=O)N(C)C)CCNCC2)CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C33H45Cl2N4O4/c1-24(40)43-30-11-7-6-10-27(30)31(41)38(4)23-26(25-12-13-28(34)29(35)22-25)14-21-39(19-8-5-9-20-39)33(32(42)37(2)3)15-17-36-18-16-33/h6-7,10-13,22,26,36H,5,8-9,14-21,23H2,1-4H3/q+1 |
| InChIKey | PRALBFWRIULNRJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|