C13H29Cl2NO — CID 87699887
azane;1,4-dichloro-4,5-dimethylundecan-2-ol (PubChem CID 87699887) has the molecular formula C13H29Cl2NO and a molecular weight of 286.29 g/mol. Its IUPAC name is azane;1,4-dichloro-4,5-dimethylundecan-2-ol.
| Compound Name | azane;1,4-dichloro-4,5-dimethylundecan-2-ol |
|---|---|
| PubChem CID | 87699887 |
| Molecular Formula | C13H29Cl2NO |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | azane;1,4-dichloro-4,5-dimethylundecan-2-ol |
| SMILES | CCCCCCC(C)C(C)(Cl)CC(O)CCl.N |
| InChI | InChI=1S/C13H26Cl2O.H3N/c1-4-5-6-7-8-11(2)13(3,15)9-12(16)10-14;/h11-12,16H,4-10H2,1-3H3;1H3 |
| InChIKey | HJEPDCHCVGHSRC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|