C17H20N2O3S — CID 87700089
4-[[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfanyl]benzoic acid (PubChem CID 87700089) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 87700089 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-[[(1R,2R)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfanyl]benzoic acid |
| SMILES | N#CCNC(=O)[C@@H]1CCCC[C@H]1CSc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c18-9-10-19-16(20)15-4-2-1-3-13(15)11-23-14-7-5-12(6-8-14)17(21)22/h5-8,13,15H,1-4,10-11H2,(H,19,20)(H,21,22)/t13-,15+/m0/s1 |
| InChIKey | YZGMRDRQQUBYRW-DZGCQCFKSA-N |
| XLogP | 2.92 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|