C13H14F6O6 — CID 87700223
ethyl 4,4-bis[(2,2,2-trifluoroacetyl)oxy]cyclohexane-1-carboxylate (PubChem CID 87700223) has the molecular formula C13H14F6O6 and a molecular weight of 380.24 g/mol. Its IUPAC name is ethyl 4,4-bis[(2,2,2-trifluoroacetyl)oxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4,4-bis[(2,2,2-trifluoroacetyl)oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87700223 |
| Molecular Formula | C13H14F6O6 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | ethyl 4,4-bis[(2,2,2-trifluoroacetyl)oxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(OC(=O)C(F)(F)F)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14F6O6/c1-2-23-8(20)7-3-5-11(6-4-7,24-9(21)12(14,15)16)25-10(22)13(17,18)19/h7H,2-6H2,1H3 |
| InChIKey | RSWDZYJRBPVAHQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|