C18H20F3N3O2S — CID 87700460
N-(cyanomethyl)-2-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide (PubChem CID 87700460) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide.
| Compound Name | N-(cyanomethyl)-2-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87700460 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-(cyanomethyl)-2-[[3-[(2,2,2-trifluoroacetyl)amino]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)C1CCCCC1CSc1cccc(NC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N3O2S/c19-18(20,21)17(26)24-13-5-3-6-14(10-13)27-11-12-4-1-2-7-15(12)16(25)23-9-8-22/h3,5-6,10,12,15H,1-2,4,7,9,11H2,(H,23,25)(H,24,26) |
| InChIKey | LHIKKNCZIMWBLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|