C19H26N2O6S3 — CID 87700500
2-[4-[[(1S,2S)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfonyl]phenyl]sulfanylethyl methanesulfonate (PubChem CID 87700500) has the molecular formula C19H26N2O6S3 and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-[4-[[(1S,2S)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfonyl]phenyl]sulfanylethyl methanesulfonate.
| Compound Name | 2-[4-[[(1S,2S)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfonyl]phenyl]sulfanylethyl methanesulfonate |
|---|---|
| PubChem CID | 87700500 |
| Molecular Formula | C19H26N2O6S3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-[4-[[(1S,2S)-2-(cyanomethylcarbamoyl)cyclohexyl]methylsulfonyl]phenyl]sulfanylethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCSc1ccc(S(=O)(=O)C[C@H]2CCCC[C@@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C19H26N2O6S3/c1-29(23,24)27-12-13-28-16-6-8-17(9-7-16)30(25,26)14-15-4-2-3-5-18(15)19(22)21-11-10-20/h6-9,15,18H,2-5,11-14H2,1H3,(H,21,22)/t15-,18+/m1/s1 |
| InChIKey | QCNJQJJZTTZEHH-QAPCUYQASA-N |
| XLogP | 1.97 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|