C18H25N3O5S3 — CID 87700510
cis-(1R,2R)-2-[[3-[bis(methylsulfonyl)amino]phenyl]sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide (PubChem CID 87700510) has the molecular formula C18H25N3O5S3 and a molecular weight of 459.62 g/mol. Its IUPAC name is cis-(1R,2R)-2-[[3-[bis(methylsulfonyl)amino]phenyl]sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-2-[[3-[bis(methylsulfonyl)amino]phenyl]sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87700510 |
| Molecular Formula | C18H25N3O5S3 |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | cis-(1R,2R)-2-[[3-[bis(methylsulfonyl)amino]phenyl]sulfanylmethyl]-N-(cyanomethyl)cyclohexane-1-carboxamide |
| SMILES | CS(=O)(=O)N(c1cccc(SC[C@@H]2CCCC[C@H]2C(=O)NCC#N)c1)S(C)(=O)=O |
| InChI | InChI=1S/C18H25N3O5S3/c1-28(23,24)21(29(2,25)26)15-7-5-8-16(12-15)27-13-14-6-3-4-9-17(14)18(22)20-11-10-19/h5,7-8,12,14,17H,3-4,6,9,11,13H2,1-2H3,(H,20,22)/t14-,17+/m0/s1 |
| InChIKey | MWCOGYISWOGMHX-WMLDXEAASA-N |
| XLogP | 1.95 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|