About 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine
3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine (PubChem CID 87700655) has the molecular formula C11H26N2O2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine.
Molecular Properties
| Compound Name | 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine |
| PubChem CID | 87700655 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine |
| SMILES | CCCN.CCN(CCC(=O)O)C(C)C |
| InChI | InChI=1S/C8H17NO2.C3H9N/c1-4-9(7(2)3)6-5-8(10)11;1-2-3-4/h7H,4-6H2,1-3H3,(H,10,11);2-4H2,1H3 |
| InChIKey | WNMCBAWXTMJYMN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine?
The IUPAC name of 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine (CID 87700655) is 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine.
What is the SMILES notation for 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine?
The canonical SMILES for 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine is CCCN.CCN(CCC(=O)O)C(C)C.
What is the InChIKey of 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine?
The InChIKey is WNMCBAWXTMJYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C3H9N/c1-4-9(7(2)3)6-5-8(10)11;1-2-3-4/h7H,4-6H2,1-3H3,(H,10,11);2-4H2,1H3.
What are the key properties of 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine?
3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine has a molecular weight of 218.34 g/mol, XLogP of 1.55, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(propan-2-yl)amino]propanoic acid;propan-1-amine is sourced from PubChem (CID 87700655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).