C17H20F4N6O3 — CID 87700683
N-hydroxy-N-[(2R)-7,7,7-trifluoro-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]carbamoyl fluoride (PubChem CID 87700683) has the molecular formula C17H20F4N6O3 and a molecular weight of 432.38 g/mol. Its IUPAC name is N-hydroxy-N-[(2R)-7,7,7-trifluoro-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]carbamoyl fluoride.
| Compound Name | N-hydroxy-N-[(2R)-7,7,7-trifluoro-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 87700683 |
| Molecular Formula | C17H20F4N6O3 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-hydroxy-N-[(2R)-7,7,7-trifluoro-2-[[(7-methyl-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]carbamoyl fluoride |
| SMILES | Cc1ccc2nc(NNC(=O)[C@H](CCCCC(F)(F)F)CN(O)C(=O)F)nnc2c1 |
| InChI | InChI=1S/C17H20F4N6O3/c1-10-5-6-12-13(8-10)23-25-16(22-12)26-24-14(28)11(9-27(30)15(18)29)4-2-3-7-17(19,20)21/h5-6,8,11,30H,2-4,7,9H2,1H3,(H,24,28)(H,22,25,26)/t11-/m1/s1 |
| InChIKey | KWEVRJGOLOPRFE-LLVKDONJSA-N |
| XLogP | 3.30 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|