About 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol
2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol (PubChem CID 87700797) has the molecular formula C28H34N6O
and a molecular weight of 470.62 g/mol. Its IUPAC name is 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol.
Molecular Properties
| Compound Name | 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol |
| PubChem CID | 87700797 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol |
| SMILES | CCC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)CC)c1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C22H29N3O.C6H5N3/c1-7-21(3,4)15-13-16(22(5,6)8-2)20(26)19(14-15)25-23-17-11-9-10-12-18(17)24-25;1-2-4-6-5(3-1)7-9-8-6/h9-14,26H,7-8H2,1-6H3;1-4H,(H,7,8,9) |
| InChIKey | NIXPZFYOBAAUAK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol?
The IUPAC name of 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol (CID 87700797) is 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol.
What is the SMILES notation for 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol?
The canonical SMILES for 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol is CCC(C)(C)c1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)CC)c1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol?
The InChIKey is NIXPZFYOBAAUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O.C6H5N3/c1-7-21(3,4)15-13-16(22(5,6)8-2)20(26)19(14-15)25-23-17-11-9-10-12-18(17)24-25;1-2-4-6-5(3-1)7-9-8-6/h9-14,26H,7-8H2,1-6H3;1-4H,(H,7,8,9).
What are the key properties of 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol?
2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol has a molecular weight of 470.62 g/mol, XLogP of 6.46, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;2-(benzotriazol-2-yl)-4,6-bis(2-methylbutan-2-yl)phenol is sourced from PubChem (CID 87700797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).