C32H33F6NO3 — CID 87701010
ethyl 2-[5-[4-[3-[4-[(E)-1,2,3,4,4,4-hexafluoro-3-hydroxybut-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-3-pyridinyl]acetate (PubChem CID 87701010) has the molecular formula C32H33F6NO3 and a molecular weight of 593.61 g/mol. Its IUPAC name is ethyl 2-[5-[4-[3-[4-[(E)-1,2,3,4,4,4-hexafluoro-3-hydroxybut-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[4-[3-[4-[(E)-1,2,3,4,4,4-hexafluoro-3-hydroxybut-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 87701010 |
| Molecular Formula | C32H33F6NO3 |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | ethyl 2-[5-[4-[3-[4-[(E)-1,2,3,4,4,4-hexafluoro-3-hydroxybut-1-enyl]-3-methylphenyl]pentan-3-yl]-2-methylphenyl]-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cncc(-c2ccc(C(CC)(CC)c3ccc(/C(F)=C(\F)C(O)(F)C(F)(F)F)c(C)c3)cc2C)c1 |
| InChI | InChI=1S/C32H33F6NO3/c1-6-30(7-2,24-10-12-26(20(5)14-24)28(33)29(34)31(35,41)32(36,37)38)23-9-11-25(19(4)13-23)22-15-21(17-39-18-22)16-27(40)42-8-3/h9-15,17-18,41H,6-8,16H2,1-5H3/b29-28+ |
| InChIKey | NKMBUKHABKFKDD-ZQHSETAFSA-N |
| XLogP | 8.41 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |