About triethylsulfanium fluoride
triethylsulfanium fluoride (PubChem CID 87701095) has the molecular formula C6H15FS
and a molecular weight of 138.25 g/mol. Its IUPAC name is triethylsulfanium fluoride.
Molecular Properties
| Compound Name | triethylsulfanium fluoride |
| PubChem CID | 87701095 |
| Molecular Formula | C6H15FS |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | triethylsulfanium fluoride |
| SMILES | CC[S+](CC)CC.[F-] |
| InChI | InChI=1S/C6H15S.FH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KFWJYDPBKXSLNU-UHFFFAOYSA-M |
| XLogP | -1.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze triethylsulfanium fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylsulfanium fluoride?
The IUPAC name of triethylsulfanium fluoride (CID 87701095) is triethylsulfanium fluoride.
What is the SMILES notation for triethylsulfanium fluoride?
The canonical SMILES for triethylsulfanium fluoride is CC[S+](CC)CC.[F-].
What is the InChIKey of triethylsulfanium fluoride?
The InChIKey is KFWJYDPBKXSLNU-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15S.FH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H/q+1;/p-1.
What are the key properties of triethylsulfanium fluoride?
triethylsulfanium fluoride has a molecular weight of 138.25 g/mol, XLogP of -1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylsulfanium fluoride is sourced from PubChem (CID 87701095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).