C15H13Cl2NO5S — CID 87701295
2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid (PubChem CID 87701295) has the molecular formula C15H13Cl2NO5S and a molecular weight of 390.24 g/mol. Its IUPAC name is 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid.
| Compound Name | 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid |
|---|---|
| PubChem CID | 87701295 |
| Molecular Formula | C15H13Cl2NO5S |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C8H8O4S.C7H5Cl2NO/c9-8-3-1-2-7(6-8)4-5-13(10,11)12;8-4-1-2-5(7(10)11)6(9)3-4/h1-6,9H,(H,10,11,12);1-3H,(H2,10,11)/b5-4+; |
| InChIKey | ZMTJPLPFGQVHBV-FXRZFVDSSA-N |
| XLogP | 3.34 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|