About 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid
2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid (PubChem CID 87701295) has the molecular formula C15H13Cl2NO5S
and a molecular weight of 390.24 g/mol. Its IUPAC name is 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid |
| PubChem CID | 87701295 |
| Molecular Formula | C15H13Cl2NO5S |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/C8H8O4S.C7H5Cl2NO/c9-8-3-1-2-7(6-8)4-5-13(10,11)12;8-4-1-2-5(7(10)11)6(9)3-4/h1-6,9H,(H,10,11,12);1-3H,(H2,10,11)/b5-4+; |
| InChIKey | ZMTJPLPFGQVHBV-FXRZFVDSSA-N |
| XLogP | 3.34 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid?
The IUPAC name of 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid (CID 87701295) is 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid.
What is the SMILES notation for 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid?
The canonical SMILES for 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid is NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)/C=C/c1cccc(O)c1.
What is the InChIKey of 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid?
The InChIKey is ZMTJPLPFGQVHBV-FXRZFVDSSA-N. The full InChI is InChI=1S/C8H8O4S.C7H5Cl2NO/c9-8-3-1-2-7(6-8)4-5-13(10,11)12;8-4-1-2-5(7(10)11)6(9)3-4/h1-6,9H,(H,10,11,12);1-3H,(H2,10,11)/b5-4+;.
What are the key properties of 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid?
2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid has a molecular weight of 390.24 g/mol, XLogP of 3.34, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobenzamide;(E)-2-(3-hydroxyphenyl)ethenesulfonic acid is sourced from PubChem (CID 87701295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).