About potassium;N,N-dimethylformamide;iodide
potassium;N,N-dimethylformamide;iodide (PubChem CID 87701364) has the molecular formula C3H7IKNO
and a molecular weight of 239.10 g/mol. Its IUPAC name is potassium;N,N-dimethylformamide;iodide.
Molecular Properties
| Compound Name | potassium;N,N-dimethylformamide;iodide |
| PubChem CID | 87701364 |
| Molecular Formula | C3H7IKNO |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 238.92 |
| IUPAC Name | potassium;N,N-dimethylformamide;iodide |
| SMILES | CN(C)C=O.[I-].[K+] |
| InChI | InChI=1S/C3H7NO.HI.K/c1-4(2)3-5;;/h3H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | KXJNZVTVRQTOOE-UHFFFAOYSA-M |
| XLogP | -6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | -6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze potassium;N,N-dimethylformamide;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;N,N-dimethylformamide;iodide?
The IUPAC name of potassium;N,N-dimethylformamide;iodide (CID 87701364) is potassium;N,N-dimethylformamide;iodide.
What is the SMILES notation for potassium;N,N-dimethylformamide;iodide?
The canonical SMILES for potassium;N,N-dimethylformamide;iodide is CN(C)C=O.[I-].[K+].
What is the InChIKey of potassium;N,N-dimethylformamide;iodide?
The InChIKey is KXJNZVTVRQTOOE-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H7NO.HI.K/c1-4(2)3-5;;/h3H,1-2H3;1H;/q;;+1/p-1.
What are the key properties of potassium;N,N-dimethylformamide;iodide?
potassium;N,N-dimethylformamide;iodide has a molecular weight of 239.10 g/mol, XLogP of -6.29, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;N,N-dimethylformamide;iodide is sourced from PubChem (CID 87701364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).