C14H21ClO3 — CID 87701598
(E,2S,7S)-7,8-dimethyl-3,6-dioxo-2-propan-2-ylnon-4-enoyl chloride (PubChem CID 87701598) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is (E,2S,7S)-7,8-dimethyl-3,6-dioxo-2-propan-2-ylnon-4-enoyl chloride.
| Compound Name | (E,2S,7S)-7,8-dimethyl-3,6-dioxo-2-propan-2-ylnon-4-enoyl chloride |
|---|---|
| PubChem CID | 87701598 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (E,2S,7S)-7,8-dimethyl-3,6-dioxo-2-propan-2-ylnon-4-enoyl chloride |
| SMILES | CC(C)[C@H](C(=O)Cl)C(=O)/C=C/C(=O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C14H21ClO3/c1-8(2)10(5)11(16)6-7-12(17)13(9(3)4)14(15)18/h6-10,13H,1-5H3/b7-6+/t10-,13-/m0/s1 |
| InChIKey | RQBHFKVLFIVFJP-UVTYEAHQSA-N |
| XLogP | 3.01 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|