C41H62ClN5O3S — CID 87701616
4-[2-[(3-chlorobenzoyl)amino]-4-[[(Z)-3-sulfanylnonadec-10-enyl]carbamoyl]phenyl]-N-ethyl-1,4-diazepane-1-carboxamide (PubChem CID 87701616) has the molecular formula C41H62ClN5O3S and a molecular weight of 740.50 g/mol. Its IUPAC name is 4-[2-[(3-chlorobenzoyl)amino]-4-[[(Z)-3-sulfanylnonadec-10-enyl]carbamoyl]phenyl]-N-ethyl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-[(3-chlorobenzoyl)amino]-4-[[(Z)-3-sulfanylnonadec-10-enyl]carbamoyl]phenyl]-N-ethyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 87701616 |
| Molecular Formula | C41H62ClN5O3S |
| Molecular Weight | 740.50 g/mol |
| Exact Mass | 739.43 |
| IUPAC Name | 4-[2-[(3-chlorobenzoyl)amino]-4-[[(Z)-3-sulfanylnonadec-10-enyl]carbamoyl]phenyl]-N-ethyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC(S)CCNC(=O)c1ccc(N2CCCN(C(=O)NCC)CC2)c(NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C41H62ClN5O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-22-36(51)25-26-44-39(48)34-23-24-38(46-27-19-28-47(30-29-46)41(50)43-4-2)37(32-34)45-40(49)33-20-18-21-35(42)31-33/h11-12,18,20-21,23-24,31-32,36,51H,3-10,13-17,19,22,25-30H2,1-2H3,(H,43,50)(H,44,48)(H,45,49)/b12-11- |
| InChIKey | XSBNOLJZBCKZHB-QXMHVHEDSA-N |
| XLogP | 9.90 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.50 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|