About (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one
(6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one (PubChem CID 87702206) has the molecular formula C25H29ClN2O6S
and a molecular weight of 521.04 g/mol. Its IUPAC name is (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one.
Molecular Properties
| Compound Name | (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one |
| PubChem CID | 87702206 |
| Molecular Formula | C25H29ClN2O6S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one |
| SMILES | CCCCCCCCSC(=O)Oc1cc(Cl)nnc1-c1ccccc1.Cc1occ(O)c(=O)c1O |
| InChI | InChI=1S/C19H23ClN2O2S.C6H6O4/c1-2-3-4-5-6-10-13-25-19(23)24-16-14-17(20)21-22-18(16)15-11-8-7-9-12-15;1-3-5(8)6(9)4(7)2-10-3/h7-9,11-12,14H,2-6,10,13H2,1H3;2,7-8H,1H3 |
| InChIKey | YEIVWPOTKRSGRY-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one?
The IUPAC name of (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one (CID 87702206) is (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one.
What is the SMILES notation for (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one?
The canonical SMILES for (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one is CCCCCCCCSC(=O)Oc1cc(Cl)nnc1-c1ccccc1.Cc1occ(O)c(=O)c1O.
What is the InChIKey of (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one?
The InChIKey is YEIVWPOTKRSGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2O2S.C6H6O4/c1-2-3-4-5-6-10-13-25-19(23)24-16-14-17(20)21-22-18(16)15-11-8-7-9-12-15;1-3-5(8)6(9)4(7)2-10-3/h7-9,11-12,14H,2-6,10,13H2,1H3;2,7-8H,1H3.
What are the key properties of (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one?
(6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one has a molecular weight of 521.04 g/mol, XLogP of 6.75, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-phenylpyridazin-4-yl) octylsulfanylformate;3,5-dihydroxy-2-methylpyran-4-one is sourced from PubChem (CID 87702206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).