C22H29F3N2O — CID 87702621
2,2,2-trifluoro-1-[4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone (PubChem CID 87702621) has the molecular formula C22H29F3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 87702621 |
| Molecular Formula | C22H29F3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[4-[2-(2-methylpyrrolidin-1-yl)ethyl]phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethanone |
| SMILES | CC1CCCN1CCc1ccc(C2CCC3CN(C(=O)C(F)(F)F)CC32)cc1 |
| InChI | InChI=1S/C22H29F3N2O/c1-15-3-2-11-26(15)12-10-16-4-6-17(7-5-16)19-9-8-18-13-27(14-20(18)19)21(28)22(23,24)25/h4-7,15,18-20H,2-3,8-14H2,1H3 |
| InChIKey | ZKUQOSOBZKLXNR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |