About 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene
4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene (PubChem CID 87703074) has the molecular formula C24H24F6
and a molecular weight of 426.44 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene.
Molecular Properties
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene |
| PubChem CID | 87703074 |
| Molecular Formula | C24H24F6 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene |
| SMILES | CC(C)CC1=Cc2c(ccc(C(C)C)c2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H24F6/c1-13(2)7-15-8-16-5-6-20(14(3)4)22(21(16)9-15)17-10-18(23(25,26)27)12-19(11-17)24(28,29)30/h5-6,9-14H,7-8H2,1-4H3 |
| InChIKey | BEDZMZHWMRJUHV-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene?
The IUPAC name of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene (CID 87703074) is 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene.
What is the SMILES notation for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene?
The canonical SMILES for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene is CC(C)CC1=Cc2c(ccc(C(C)C)c2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1.
What is the InChIKey of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene?
The InChIKey is BEDZMZHWMRJUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24F6/c1-13(2)7-15-8-16-5-6-20(14(3)4)22(21(16)9-15)17-10-18(23(25,26)27)12-19(11-17)24(28,29)30/h5-6,9-14H,7-8H2,1-4H3.
What are the key properties of 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene?
4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene has a molecular weight of 426.44 g/mol, XLogP of 8.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(trifluoromethyl)phenyl]-2-(2-methylpropyl)-5-propan-2-yl-1H-indene is sourced from PubChem (CID 87703074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).