C30H42 — CID 87703601
5-tert-butyl-4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-indene (PubChem CID 87703601) has the molecular formula C30H42 and a molecular weight of 402.67 g/mol. Its IUPAC name is 5-tert-butyl-4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-indene.
| Compound Name | 5-tert-butyl-4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-indene |
|---|---|
| PubChem CID | 87703601 |
| Molecular Formula | C30H42 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | 5-tert-butyl-4-(3,5-ditert-butylphenyl)-2-propan-2-yl-1H-indene |
| SMILES | CC(C)C1=Cc2c(ccc(C(C)(C)C)c2-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C30H42/c1-19(2)21-14-20-12-13-26(30(9,10)11)27(25(20)17-21)22-15-23(28(3,4)5)18-24(16-22)29(6,7)8/h12-13,15-19H,14H2,1-11H3 |
| InChIKey | PCDBVMYRJVETHO-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |