C22H26 — CID 87703739
2-(2-methylpropyl)-4-phenyl-5-propyl-1H-indene (PubChem CID 87703739) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(2-methylpropyl)-4-phenyl-5-propyl-1H-indene.
| Compound Name | 2-(2-methylpropyl)-4-phenyl-5-propyl-1H-indene |
|---|---|
| PubChem CID | 87703739 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-(2-methylpropyl)-4-phenyl-5-propyl-1H-indene |
| SMILES | CCCc1ccc2c(c1-c1ccccc1)C=C(CC(C)C)C2 |
| InChI | InChI=1S/C22H26/c1-4-8-18-11-12-20-14-17(13-16(2)3)15-21(20)22(18)19-9-6-5-7-10-19/h5-7,9-12,15-16H,4,8,13-14H2,1-3H3 |
| InChIKey | VKRNFPAJRIURDB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |