C9H16N2O2 — CID 87704667
N-carbamoyl-N-(2,2,3,3-tetramethylcyclopropyl)formamide (PubChem CID 87704667) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-carbamoyl-N-(2,2,3,3-tetramethylcyclopropyl)formamide.
| Compound Name | N-carbamoyl-N-(2,2,3,3-tetramethylcyclopropyl)formamide |
|---|---|
| PubChem CID | 87704667 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-carbamoyl-N-(2,2,3,3-tetramethylcyclopropyl)formamide |
| SMILES | CC1(C)C(N(C=O)C(N)=O)C1(C)C |
| InChI | InChI=1S/C9H16N2O2/c1-8(2)6(9(8,3)4)11(5-12)7(10)13/h5-6H,1-4H3,(H2,10,13) |
| InChIKey | MFFPCFZSIMLBPR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|