About furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde
furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde (PubChem CID 87704681) has the molecular formula C16H20O5
and a molecular weight of 292.33 g/mol. Its IUPAC name is furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde.
Molecular Properties
| Compound Name | furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde |
| PubChem CID | 87704681 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde |
| SMILES | CCC(C)C=O.Cc1ccc(C=O)o1.O=Cc1ccco1 |
| InChI | InChI=1S/C6H6O2.C5H4O2.C5H10O/c1-5-2-3-6(4-7)8-5;6-4-5-2-1-3-7-5;1-3-5(2)4-6/h2-4H,1H3;1-4H;4-5H,3H2,1-2H3 |
| InChIKey | HUCSMSDGLMPTTI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde?
The IUPAC name of furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde (CID 87704681) is furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde.
What is the SMILES notation for furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde?
The canonical SMILES for furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde is CCC(C)C=O.Cc1ccc(C=O)o1.O=Cc1ccco1.
What is the InChIKey of furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde?
The InChIKey is HUCSMSDGLMPTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C5H4O2.C5H10O/c1-5-2-3-6(4-7)8-5;6-4-5-2-1-3-7-5;1-3-5(2)4-6/h2-4H,1H3;1-4H;4-5H,3H2,1-2H3.
What are the key properties of furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde?
furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde has a molecular weight of 292.33 g/mol, XLogP of 3.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carbaldehyde;2-methylbutanal;5-methylfuran-2-carbaldehyde is sourced from PubChem (CID 87704681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).