About 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione
3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione (PubChem CID 87704941) has the molecular formula C21H20N4O2
and a molecular weight of 360.42 g/mol. Its IUPAC name is 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione.
Molecular Properties
| Compound Name | 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione |
| PubChem CID | 87704941 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(C#Cc3cccc(C)c3)n2CC)n(CC)c1=O |
| InChI | InChI=1S/C21H20N4O2/c1-5-13-25-20(26)18-19(24(7-3)21(25)27)22-17(23(18)6-2)12-11-16-10-8-9-15(4)14-16/h1,8-10,14H,6-7,13H2,2-4H3 |
| InChIKey | SKBOJABJYLKNAI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione?
The IUPAC name of 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione (CID 87704941) is 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione.
What is the SMILES notation for 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione?
The canonical SMILES for 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione is C#CCn1c(=O)c2c(nc(C#Cc3cccc(C)c3)n2CC)n(CC)c1=O.
What is the InChIKey of 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione?
The InChIKey is SKBOJABJYLKNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O2/c1-5-13-25-20(26)18-19(24(7-3)21(25)27)22-17(23(18)6-2)12-11-16-10-8-9-15(4)14-16/h1,8-10,14H,6-7,13H2,2-4H3.
What are the key properties of 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione?
3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione has a molecular weight of 360.42 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diethyl-8-[2-(3-methylphenyl)ethynyl]-1-prop-2-ynylpurine-2,6-dione is sourced from PubChem (CID 87704941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).