About pyrrolo[3,2-b]pyridine-2-thione
pyrrolo[3,2-b]pyridine-2-thione (PubChem CID 87705818) has the molecular formula C7H4N2S
and a molecular weight of 148.19 g/mol. Its IUPAC name is pyrrolo[3,2-b]pyridine-2-thione.
Molecular Properties
| Compound Name | pyrrolo[3,2-b]pyridine-2-thione |
| PubChem CID | 87705818 |
| Molecular Formula | C7H4N2S |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | pyrrolo[3,2-b]pyridine-2-thione |
| SMILES | S=C1C=c2ncccc2=N1 |
| InChI | InChI=1S/C7H4N2S/c10-7-4-6-5(9-7)2-1-3-8-6/h1-4H |
| InChIKey | IQPIMAJAQBMJNJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyrrolo[3,2-b]pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[3,2-b]pyridine-2-thione?
The IUPAC name of pyrrolo[3,2-b]pyridine-2-thione (CID 87705818) is pyrrolo[3,2-b]pyridine-2-thione.
What is the SMILES notation for pyrrolo[3,2-b]pyridine-2-thione?
The canonical SMILES for pyrrolo[3,2-b]pyridine-2-thione is S=C1C=c2ncccc2=N1.
What is the InChIKey of pyrrolo[3,2-b]pyridine-2-thione?
The InChIKey is IQPIMAJAQBMJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2S/c10-7-4-6-5(9-7)2-1-3-8-6/h1-4H.
What are the key properties of pyrrolo[3,2-b]pyridine-2-thione?
pyrrolo[3,2-b]pyridine-2-thione has a molecular weight of 148.19 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[3,2-b]pyridine-2-thione is sourced from PubChem (CID 87705818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).