C14H20O7 — CID 87705978
4-O-[1-(3,3-dimethylbutanoyloxy)-1-oxopropan-2-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 87705978) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-O-[1-(3,3-dimethylbutanoyloxy)-1-oxopropan-2-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[1-(3,3-dimethylbutanoyloxy)-1-oxopropan-2-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87705978 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-O-[1-(3,3-dimethylbutanoyloxy)-1-oxopropan-2-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC(C)C(=O)OC(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H20O7/c1-9(20-11(16)7-6-10(15)19-5)13(18)21-12(17)8-14(2,3)4/h6-7,9H,8H2,1-5H3/b7-6+ |
| InChIKey | UQNJBKQQXDHPIG-VOTSOKGWSA-N |
| XLogP | 1.15 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|