About 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate
4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate (PubChem CID 87706155) has the molecular formula C21H38O6Si
and a molecular weight of 414.62 g/mol. Its IUPAC name is 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate |
| PubChem CID | 87706155 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate |
| SMILES | CCCOC(=O)/C=C/C(=O)OCCCCC(=O)O[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C21H38O6Si/c1-5-14-25-19(22)12-13-20(23)26-15-10-9-11-21(24)27-28(16-6-2,17-7-3)18-8-4/h12-13H,5-11,14-18H2,1-4H3/b13-12+ |
| InChIKey | CDUXLDXWMJCSMY-OUKQBFOZSA-N |
| XLogP | 4.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate?
The IUPAC name of 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate (CID 87706155) is 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate.
What is the SMILES notation for 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate?
The canonical SMILES for 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate is CCCOC(=O)/C=C/C(=O)OCCCCC(=O)O[Si](CCC)(CCC)CCC.
What is the InChIKey of 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate?
The InChIKey is CDUXLDXWMJCSMY-OUKQBFOZSA-N. The full InChI is InChI=1S/C21H38O6Si/c1-5-14-25-19(22)12-13-20(23)26-15-10-9-11-21(24)27-28(16-6-2,17-7-3)18-8-4/h12-13H,5-11,14-18H2,1-4H3/b13-12+.
What are the key properties of 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate?
4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate has a molecular weight of 414.62 g/mol, XLogP of 4.93, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(5-oxo-5-tripropylsilyloxypentyl) 1-O-propyl (E)-but-2-enedioate is sourced from PubChem (CID 87706155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).