About (4-formyl-2-nitrophenyl) 3-chloropropanoate
(4-formyl-2-nitrophenyl) 3-chloropropanoate (PubChem CID 87706211) has the molecular formula C10H8ClNO5
and a molecular weight of 257.63 g/mol. Its IUPAC name is (4-formyl-2-nitrophenyl) 3-chloropropanoate.
Molecular Properties
| Compound Name | (4-formyl-2-nitrophenyl) 3-chloropropanoate |
| PubChem CID | 87706211 |
| Molecular Formula | C10H8ClNO5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (4-formyl-2-nitrophenyl) 3-chloropropanoate |
| SMILES | O=Cc1ccc(OC(=O)CCCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8ClNO5/c11-4-3-10(14)17-9-2-1-7(6-13)5-8(9)12(15)16/h1-2,5-6H,3-4H2 |
| InChIKey | PRZIBFKHEPMWAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-2-nitrophenyl) 3-chloropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-2-nitrophenyl) 3-chloropropanoate?
The IUPAC name of (4-formyl-2-nitrophenyl) 3-chloropropanoate (CID 87706211) is (4-formyl-2-nitrophenyl) 3-chloropropanoate.
What is the SMILES notation for (4-formyl-2-nitrophenyl) 3-chloropropanoate?
The canonical SMILES for (4-formyl-2-nitrophenyl) 3-chloropropanoate is O=Cc1ccc(OC(=O)CCCl)c([N+](=O)[O-])c1.
What is the InChIKey of (4-formyl-2-nitrophenyl) 3-chloropropanoate?
The InChIKey is PRZIBFKHEPMWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO5/c11-4-3-10(14)17-9-2-1-7(6-13)5-8(9)12(15)16/h1-2,5-6H,3-4H2.
What are the key properties of (4-formyl-2-nitrophenyl) 3-chloropropanoate?
(4-formyl-2-nitrophenyl) 3-chloropropanoate has a molecular weight of 257.63 g/mol, XLogP of 1.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-2-nitrophenyl) 3-chloropropanoate is sourced from PubChem (CID 87706211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).