C44H27F10IO6S3 — CID 87706415
[4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(2,3,4,5,6-pentafluorobenzenesulfonate) (PubChem CID 87706415) has the molecular formula C44H27F10IO6S3 and a molecular weight of 1064.78 g/mol. Its IUPAC name is [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(2,3,4,5,6-pentafluorobenzenesulfonate).
| Compound Name | [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(2,3,4,5,6-pentafluorobenzenesulfonate) |
|---|---|
| PubChem CID | 87706415 |
| Molecular Formula | C44H27F10IO6S3 |
| Molecular Weight | 1064.78 g/mol |
| Exact Mass | 1063.99 |
| IUPAC Name | [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(2,3,4,5,6-pentafluorobenzenesulfonate) |
| SMILES | Cc1ccccc1[I+]c1ccc(Cc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F.O=S(=O)([O-])c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H27IS.2C6HF5O3S/c1-25-10-8-9-15-32(25)33-28-20-16-26(17-21-28)24-27-18-22-31(23-19-27)34(29-11-4-2-5-12-29)30-13-6-3-7-14-30;2*7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h2-23H,24H2,1H3;2*(H,12,13,14)/q+2;;/p-2 |
| InChIKey | WUGIMTJNPHXLHK-UHFFFAOYSA-L |
| XLogP | 7.38 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1064.78 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|