About tris(4-methylphenyl)silyl 5-chloropentanoate
tris(4-methylphenyl)silyl 5-chloropentanoate (PubChem CID 87706425) has the molecular formula C26H29ClO2Si
and a molecular weight of 437.06 g/mol. Its IUPAC name is tris(4-methylphenyl)silyl 5-chloropentanoate.
Molecular Properties
| Compound Name | tris(4-methylphenyl)silyl 5-chloropentanoate |
| PubChem CID | 87706425 |
| Molecular Formula | C26H29ClO2Si |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | tris(4-methylphenyl)silyl 5-chloropentanoate |
| SMILES | Cc1ccc([Si](OC(=O)CCCCCl)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H29ClO2Si/c1-20-7-13-23(14-8-20)30(24-15-9-21(2)10-16-24,25-17-11-22(3)12-18-25)29-26(28)6-4-5-19-27/h7-18H,4-6,19H2,1-3H3 |
| InChIKey | DOLPOAWYHJQSNX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tris(4-methylphenyl)silyl 5-chloropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-methylphenyl)silyl 5-chloropentanoate?
The IUPAC name of tris(4-methylphenyl)silyl 5-chloropentanoate (CID 87706425) is tris(4-methylphenyl)silyl 5-chloropentanoate.
What is the SMILES notation for tris(4-methylphenyl)silyl 5-chloropentanoate?
The canonical SMILES for tris(4-methylphenyl)silyl 5-chloropentanoate is Cc1ccc([Si](OC(=O)CCCCCl)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of tris(4-methylphenyl)silyl 5-chloropentanoate?
The InChIKey is DOLPOAWYHJQSNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29ClO2Si/c1-20-7-13-23(14-8-20)30(24-15-9-21(2)10-16-24,25-17-11-22(3)12-18-25)29-26(28)6-4-5-19-27/h7-18H,4-6,19H2,1-3H3.
What are the key properties of tris(4-methylphenyl)silyl 5-chloropentanoate?
tris(4-methylphenyl)silyl 5-chloropentanoate has a molecular weight of 437.06 g/mol, XLogP of 4.53, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-methylphenyl)silyl 5-chloropentanoate is sourced from PubChem (CID 87706425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).