About (4-bromo-2,6-dichlorophenyl) 2-chloroacetate
(4-bromo-2,6-dichlorophenyl) 2-chloroacetate (PubChem CID 87706469) has the molecular formula C8H4BrCl3O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is (4-bromo-2,6-dichlorophenyl) 2-chloroacetate.
Molecular Properties
| Compound Name | (4-bromo-2,6-dichlorophenyl) 2-chloroacetate |
| PubChem CID | 87706469 |
| Molecular Formula | C8H4BrCl3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 315.85 |
| IUPAC Name | (4-bromo-2,6-dichlorophenyl) 2-chloroacetate |
| SMILES | O=C(CCl)Oc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H4BrCl3O2/c9-4-1-5(11)8(6(12)2-4)14-7(13)3-10/h1-2H,3H2 |
| InChIKey | QMRJZSIZEGPJOB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2,6-dichlorophenyl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2,6-dichlorophenyl) 2-chloroacetate?
The IUPAC name of (4-bromo-2,6-dichlorophenyl) 2-chloroacetate (CID 87706469) is (4-bromo-2,6-dichlorophenyl) 2-chloroacetate.
What is the SMILES notation for (4-bromo-2,6-dichlorophenyl) 2-chloroacetate?
The canonical SMILES for (4-bromo-2,6-dichlorophenyl) 2-chloroacetate is O=C(CCl)Oc1c(Cl)cc(Br)cc1Cl.
What is the InChIKey of (4-bromo-2,6-dichlorophenyl) 2-chloroacetate?
The InChIKey is QMRJZSIZEGPJOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrCl3O2/c9-4-1-5(11)8(6(12)2-4)14-7(13)3-10/h1-2H,3H2.
What are the key properties of (4-bromo-2,6-dichlorophenyl) 2-chloroacetate?
(4-bromo-2,6-dichlorophenyl) 2-chloroacetate has a molecular weight of 318.38 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2,6-dichlorophenyl) 2-chloroacetate is sourced from PubChem (CID 87706469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).