About (2-fluoro-6-formylphenyl) 5-chloropentanoate
(2-fluoro-6-formylphenyl) 5-chloropentanoate (PubChem CID 87706600) has the molecular formula C12H12ClFO3
and a molecular weight of 258.68 g/mol. Its IUPAC name is (2-fluoro-6-formylphenyl) 5-chloropentanoate.
Molecular Properties
| Compound Name | (2-fluoro-6-formylphenyl) 5-chloropentanoate |
| PubChem CID | 87706600 |
| Molecular Formula | C12H12ClFO3 |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (2-fluoro-6-formylphenyl) 5-chloropentanoate |
| SMILES | O=Cc1cccc(F)c1OC(=O)CCCCCl |
| InChI | InChI=1S/C12H12ClFO3/c13-7-2-1-6-11(16)17-12-9(8-15)4-3-5-10(12)14/h3-5,8H,1-2,6-7H2 |
| InChIKey | AHHGADKGKNFILT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-6-formylphenyl) 5-chloropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-6-formylphenyl) 5-chloropentanoate?
The IUPAC name of (2-fluoro-6-formylphenyl) 5-chloropentanoate (CID 87706600) is (2-fluoro-6-formylphenyl) 5-chloropentanoate.
What is the SMILES notation for (2-fluoro-6-formylphenyl) 5-chloropentanoate?
The canonical SMILES for (2-fluoro-6-formylphenyl) 5-chloropentanoate is O=Cc1cccc(F)c1OC(=O)CCCCCl.
What is the InChIKey of (2-fluoro-6-formylphenyl) 5-chloropentanoate?
The InChIKey is AHHGADKGKNFILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClFO3/c13-7-2-1-6-11(16)17-12-9(8-15)4-3-5-10(12)14/h3-5,8H,1-2,6-7H2.
What are the key properties of (2-fluoro-6-formylphenyl) 5-chloropentanoate?
(2-fluoro-6-formylphenyl) 5-chloropentanoate has a molecular weight of 258.68 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-6-formylphenyl) 5-chloropentanoate is sourced from PubChem (CID 87706600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).