About 1,1,5-trichloropentane-2,3-dione
1,1,5-trichloropentane-2,3-dione (PubChem CID 87707043) has the molecular formula C5H5Cl3O2
and a molecular weight of 203.45 g/mol. Its IUPAC name is 1,1,5-trichloropentane-2,3-dione.
Molecular Properties
| Compound Name | 1,1,5-trichloropentane-2,3-dione |
| PubChem CID | 87707043 |
| Molecular Formula | C5H5Cl3O2 |
| Molecular Weight | 203.45 g/mol |
| Exact Mass | 201.94 |
| IUPAC Name | 1,1,5-trichloropentane-2,3-dione |
| SMILES | O=C(CCCl)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C5H5Cl3O2/c6-2-1-3(9)4(10)5(7)8/h5H,1-2H2 |
| InChIKey | WUSBKYSYSWOACU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1,5-trichloropentane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,5-trichloropentane-2,3-dione?
The IUPAC name of 1,1,5-trichloropentane-2,3-dione (CID 87707043) is 1,1,5-trichloropentane-2,3-dione.
What is the SMILES notation for 1,1,5-trichloropentane-2,3-dione?
The canonical SMILES for 1,1,5-trichloropentane-2,3-dione is O=C(CCCl)C(=O)C(Cl)Cl.
What is the InChIKey of 1,1,5-trichloropentane-2,3-dione?
The InChIKey is WUSBKYSYSWOACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl3O2/c6-2-1-3(9)4(10)5(7)8/h5H,1-2H2.
What are the key properties of 1,1,5-trichloropentane-2,3-dione?
1,1,5-trichloropentane-2,3-dione has a molecular weight of 203.45 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,5-trichloropentane-2,3-dione is sourced from PubChem (CID 87707043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).