C12H20S3 — CID 87707092
2-[2,2-bis(thiiran-2-ylmethyl)butyl]thiirane (PubChem CID 87707092) has the molecular formula C12H20S3 and a molecular weight of 260.49 g/mol. Its IUPAC name is 2-[2,2-bis(thiiran-2-ylmethyl)butyl]thiirane.
| Compound Name | 2-[2,2-bis(thiiran-2-ylmethyl)butyl]thiirane |
|---|---|
| PubChem CID | 87707092 |
| Molecular Formula | C12H20S3 |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-[2,2-bis(thiiran-2-ylmethyl)butyl]thiirane |
| SMILES | CCC(CC1CS1)(CC1CS1)CC1CS1 |
| InChI | InChI=1S/C12H20S3/c1-2-12(3-9-6-13-9,4-10-7-14-10)5-11-8-15-11/h9-11H,2-8H2,1H3 |
| InChIKey | OAVJJHBOMPFFQE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|