C8HCl4N2+ — CID 87707146
hydron;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile (PubChem CID 87707146) has the molecular formula C8HCl4N2+ and a molecular weight of 266.92 g/mol. Its IUPAC name is hydron;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile.
| Compound Name | hydron;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 87707146 |
| Molecular Formula | C8HCl4N2+ |
| Molecular Weight | 266.92 g/mol |
| Exact Mass | 264.89 |
| IUPAC Name | hydron;2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl.[H+] |
| InChI | InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14/p+1 |
| InChIKey | CRQQGFGUEAVUIL-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|