C34H27F6IO6S3 — CID 87707150
[4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(trifluoromethanesulfonate) (PubChem CID 87707150) has the molecular formula C34H27F6IO6S3 and a molecular weight of 868.68 g/mol. Its IUPAC name is [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(trifluoromethanesulfonate).
| Compound Name | [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(trifluoromethanesulfonate) |
|---|---|
| PubChem CID | 87707150 |
| Molecular Formula | C34H27F6IO6S3 |
| Molecular Weight | 868.68 g/mol |
| Exact Mass | 867.99 |
| IUPAC Name | [4-[[4-(2-methylphenyl)iodoniophenyl]methyl]phenyl]-diphenylsulfanium;bis(trifluoromethanesulfonate) |
| SMILES | Cc1ccccc1[I+]c1ccc(Cc2ccc([S+](c3ccccc3)c3ccccc3)cc2)cc1.O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C32H27IS.2CHF3O3S/c1-25-10-8-9-15-32(25)33-28-20-16-26(17-21-28)24-27-18-22-31(23-19-27)34(29-11-4-2-5-12-29)30-13-6-3-7-14-30;2*2-1(3,4)8(5,6)7/h2-23H,24H2,1H3;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | BNPZJHKATBFUBG-UHFFFAOYSA-L |
| XLogP | 4.91 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|