About 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine
2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine (PubChem CID 87707474) has the molecular formula C11H27BrN4O9P2
and a molecular weight of 501.21 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine.
Molecular Properties
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine |
| PubChem CID | 87707474 |
| Molecular Formula | C11H27BrN4O9P2 |
| Molecular Weight | 501.21 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine |
| SMILES | C1CNCCN1.CCC(Br)(CC)C(=O)NC(N)=O.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C7H13BrN2O2.C4H10N2.H4O7P2/c1-3-7(8,4-2)5(11)10-6(9)12;1-2-6-4-3-5-1;1-8(2,3)7-9(4,5)6/h3-4H2,1-2H3,(H3,9,10,11,12);5-6H,1-4H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | OUQFRZRVRLQWKW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 220.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine?
The IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine (CID 87707474) is 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine.
What is the SMILES notation for 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine?
The canonical SMILES for 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine is C1CNCCN1.CCC(Br)(CC)C(=O)NC(N)=O.O=P(O)(O)OP(=O)(O)O.
What is the InChIKey of 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine?
The InChIKey is OUQFRZRVRLQWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrN2O2.C4H10N2.H4O7P2/c1-3-7(8,4-2)5(11)10-6(9)12;1-2-6-4-3-5-1;1-8(2,3)7-9(4,5)6/h3-4H2,1-2H3,(H3,9,10,11,12);5-6H,1-4H2;(H2,1,2,3)(H2,4,5,6).
What are the key properties of 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine?
2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine has a molecular weight of 501.21 g/mol, XLogP of -0.50, 5 rotatable bonds, 8 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-carbamoyl-2-ethylbutanamide;phosphono dihydrogen phosphate;piperazine is sourced from PubChem (CID 87707474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).