C28H29F4N3O6S — CID 87707667
2-[2-amino-4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[4-[4-(trifluoromethyl)phenyl]butylamino]propyl]phenoxy]-2-fluoroacetic acid (PubChem CID 87707667) has the molecular formula C28H29F4N3O6S and a molecular weight of 611.61 g/mol. Its IUPAC name is 2-[2-amino-4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[4-[4-(trifluoromethyl)phenyl]butylamino]propyl]phenoxy]-2-fluoroacetic acid.
| Compound Name | 2-[2-amino-4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[4-[4-(trifluoromethyl)phenyl]butylamino]propyl]phenoxy]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 87707667 |
| Molecular Formula | C28H29F4N3O6S |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 2-[2-amino-4-[(2S)-2-(benzenesulfonamido)-3-oxo-3-[4-[4-(trifluoromethyl)phenyl]butylamino]propyl]phenoxy]-2-fluoroacetic acid |
| SMILES | Nc1cc(C[C@H](NS(=O)(=O)c2ccccc2)C(=O)NCCCCc2ccc(C(F)(F)F)cc2)ccc1OC(F)C(=O)O |
| InChI | InChI=1S/C28H29F4N3O6S/c29-25(27(37)38)41-24-14-11-19(16-22(24)33)17-23(35-42(39,40)21-7-2-1-3-8-21)26(36)34-15-5-4-6-18-9-12-20(13-10-18)28(30,31)32/h1-3,7-14,16,23,25,35H,4-6,15,17,33H2,(H,34,36)(H,37,38)/t23-,25?/m0/s1 |
| InChIKey | FKFDMADZQLOYIA-LFQPHHBNSA-N |
| XLogP | 4.08 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|