C33H31F3N2O — CID 87707703
2-[(2S)-2-benzyl-4-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]-2-phenylacetaldehyde (PubChem CID 87707703) has the molecular formula C33H31F3N2O and a molecular weight of 528.62 g/mol. Its IUPAC name is 2-[(2S)-2-benzyl-4-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]-2-phenylacetaldehyde.
| Compound Name | 2-[(2S)-2-benzyl-4-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 87707703 |
| Molecular Formula | C33H31F3N2O |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[(2S)-2-benzyl-4-[[4-[2-(trifluoromethyl)phenyl]phenyl]methyl]piperazin-1-yl]-2-phenylacetaldehyde |
| SMILES | O=CC(c1ccccc1)N1CCN(Cc2ccc(-c3ccccc3C(F)(F)F)cc2)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H31F3N2O/c34-33(35,36)31-14-8-7-13-30(31)27-17-15-26(16-18-27)22-37-19-20-38(32(24-39)28-11-5-2-6-12-28)29(23-37)21-25-9-3-1-4-10-25/h1-18,24,29,32H,19-23H2/t29-,32?/m0/s1 |
| InChIKey | KPELWFNCBSLVCW-QGFKTNLFSA-N |
| XLogP | 7.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|