C11H10BrN3O2 — CID 87707717
2-(6-bromo-1,2,4-benzotriazin-3-yl)-2-ethoxyacetaldehyde (PubChem CID 87707717) has the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. Its IUPAC name is 2-(6-bromo-1,2,4-benzotriazin-3-yl)-2-ethoxyacetaldehyde.
| Compound Name | 2-(6-bromo-1,2,4-benzotriazin-3-yl)-2-ethoxyacetaldehyde |
|---|---|
| PubChem CID | 87707717 |
| Molecular Formula | C11H10BrN3O2 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-(6-bromo-1,2,4-benzotriazin-3-yl)-2-ethoxyacetaldehyde |
| SMILES | CCOC(C=O)c1nnc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C11H10BrN3O2/c1-2-17-10(6-16)11-13-9-5-7(12)3-4-8(9)14-15-11/h3-6,10H,2H2,1H3 |
| InChIKey | WECNRENDISEHKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|