C8H16N2O4 — CID 87708395
(3R,4S,5R)-N-acetyl-4-amino-3,5-dihydroxyhexanamide (PubChem CID 87708395) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is (3R,4S,5R)-N-acetyl-4-amino-3,5-dihydroxyhexanamide.
| Compound Name | (3R,4S,5R)-N-acetyl-4-amino-3,5-dihydroxyhexanamide |
|---|---|
| PubChem CID | 87708395 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (3R,4S,5R)-N-acetyl-4-amino-3,5-dihydroxyhexanamide |
| SMILES | CC(=O)NC(=O)C[C@@H](O)[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C8H16N2O4/c1-4(11)8(9)6(13)3-7(14)10-5(2)12/h4,6,8,11,13H,3,9H2,1-2H3,(H,10,12,14)/t4-,6-,8+/m1/s1 |
| InChIKey | AOZNUFMULCBLFC-DVZGVGDCSA-N |
| XLogP | -1.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |