About 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea
1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea (PubChem CID 87708424) has the molecular formula C16H18N6OS
and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea.
Molecular Properties
| Compound Name | 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea |
| PubChem CID | 87708424 |
| Molecular Formula | C16H18N6OS |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea |
| SMILES | Nc1ncc(-c2ccc(NC(=O)NCCCc3ncc[nH]3)cc2)s1 |
| InChI | InChI=1S/C16H18N6OS/c17-15-21-10-13(24-15)11-3-5-12(6-4-11)22-16(23)20-7-1-2-14-18-8-9-19-14/h3-6,8-10H,1-2,7H2,(H2,17,21)(H,18,19)(H2,20,22,23) |
| InChIKey | NFKGCVQHJGAJJV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea?
The IUPAC name of 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea (CID 87708424) is 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea.
What is the SMILES notation for 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea?
The canonical SMILES for 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea is Nc1ncc(-c2ccc(NC(=O)NCCCc3ncc[nH]3)cc2)s1.
What is the InChIKey of 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea?
The InChIKey is NFKGCVQHJGAJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6OS/c17-15-21-10-13(24-15)11-3-5-12(6-4-11)22-16(23)20-7-1-2-14-18-8-9-19-14/h3-6,8-10H,1-2,7H2,(H2,17,21)(H,18,19)(H2,20,22,23).
What are the key properties of 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea?
1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea has a molecular weight of 342.43 g/mol, XLogP of 2.87, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-amino-1,3-thiazol-5-yl)phenyl]-3-[3-(1H-imidazol-2-yl)propyl]urea is sourced from PubChem (CID 87708424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).