About ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite
ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite (PubChem CID 87708805) has the molecular formula C25H21ClO3Se
and a molecular weight of 483.85 g/mol. Its IUPAC name is ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite.
Molecular Properties
| Compound Name | ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite |
| PubChem CID | 87708805 |
| Molecular Formula | C25H21ClO3Se |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccc(C)cc2C1=O.Cl[Se]c1ccccc1 |
| InChI | InChI=1S/C19H16O3.C6H5ClSe/c1-3-22-19(21)17-16(13-7-5-4-6-8-13)14-10-9-12(2)11-15(14)18(17)20;7-8-6-4-2-1-3-5-6/h4-11H,3H2,1-2H3;1-5H |
| InChIKey | XXKYLEXDENCFTB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite?
The IUPAC name of ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite (CID 87708805) is ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite.
What is the SMILES notation for ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite?
The canonical SMILES for ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite is CCOC(=O)C1=C(c2ccccc2)c2ccc(C)cc2C1=O.Cl[Se]c1ccccc1.
What is the InChIKey of ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite?
The InChIKey is XXKYLEXDENCFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O3.C6H5ClSe/c1-3-22-19(21)17-16(13-7-5-4-6-8-13)14-10-9-12(2)11-15(14)18(17)20;7-8-6-4-2-1-3-5-6/h4-11H,3H2,1-2H3;1-5H.
What are the key properties of ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite?
ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite has a molecular weight of 483.85 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-3-oxo-1-phenylindene-2-carboxylate;phenyl selenohypochlorite is sourced from PubChem (CID 87708805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).