About 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine
5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine (PubChem CID 87709397) has the molecular formula C12H10Br3NO4S2
and a molecular weight of 536.06 g/mol. Its IUPAC name is 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine.
Molecular Properties
| Compound Name | 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine |
| PubChem CID | 87709397 |
| Molecular Formula | C12H10Br3NO4S2 |
| Molecular Weight | 536.06 g/mol |
| Exact Mass | 532.76 |
| IUPAC Name | 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine |
| SMILES | O=S(=O)(c1ccccn1)C(Br)(Br)Br.O=S(=O)=C1C=CC=CC1 |
| InChI | InChI=1S/C6H4Br3NO2S.C6H6O2S/c7-6(8,9)13(11,12)5-3-1-2-4-10-5;7-9(8)6-4-2-1-3-5-6/h1-4H;1-4H,5H2 |
| InChIKey | SAOZFEKEUSQIHN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.06 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine?
The IUPAC name of 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine (CID 87709397) is 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine.
What is the SMILES notation for 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine?
The canonical SMILES for 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine is O=S(=O)(c1ccccn1)C(Br)(Br)Br.O=S(=O)=C1C=CC=CC1.
What is the InChIKey of 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine?
The InChIKey is SAOZFEKEUSQIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br3NO2S.C6H6O2S/c7-6(8,9)13(11,12)5-3-1-2-4-10-5;7-9(8)6-4-2-1-3-5-6/h1-4H;1-4H,5H2.
What are the key properties of 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine?
5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine has a molecular weight of 536.06 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfonylcyclohexa-1,3-diene;2-(tribromomethylsulfonyl)pyridine is sourced from PubChem (CID 87709397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).