About 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride
3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride (PubChem CID 87710202) has the molecular formula C10H17ClN2
and a molecular weight of 200.71 g/mol. Its IUPAC name is 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride |
| PubChem CID | 87710202 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CCc1c(C)c(N)cc(C)c1N.Cl |
| InChI | InChI=1S/C10H16N2.ClH/c1-4-8-7(3)9(11)5-6(2)10(8)12;/h5H,4,11-12H2,1-3H3;1H |
| InChIKey | HRHUFQVKFNBYIO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride?
The IUPAC name of 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride (CID 87710202) is 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride.
What is the SMILES notation for 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride?
The canonical SMILES for 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride is CCc1c(C)c(N)cc(C)c1N.Cl.
What is the InChIKey of 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride?
The InChIKey is HRHUFQVKFNBYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.ClH/c1-4-8-7(3)9(11)5-6(2)10(8)12;/h5H,4,11-12H2,1-3H3;1H.
What are the key properties of 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride?
3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride has a molecular weight of 200.71 g/mol, XLogP of 2.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,5-dimethylbenzene-1,4-diamine;hydrochloride is sourced from PubChem (CID 87710202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).