About 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline
4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline (PubChem CID 87710560) has the molecular formula C32H35Cl3N6
and a molecular weight of 610.03 g/mol. Its IUPAC name is 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline.
Molecular Properties
| Compound Name | 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline |
| PubChem CID | 87710560 |
| Molecular Formula | C32H35Cl3N6 |
| Molecular Weight | 610.03 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline |
| SMILES | CC(c1ccc(Cl)cc1)(c1nc(Cl)c2c(C(C)(c3ccc(Cl)cc3)N3CCNCC3)cccc2n1)N1CCNCC1 |
| InChI | InChI=1S/C32H35Cl3N6/c1-31(40-18-14-36-15-19-40,22-6-10-24(33)11-7-22)26-4-3-5-27-28(26)29(35)39-30(38-27)32(2,41-20-16-37-17-21-41)23-8-12-25(34)13-9-23/h3-13,36-37H,14-21H2,1-2H3 |
| InChIKey | AJSXVEDTTGRNCA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.03 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline?
The IUPAC name of 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline (CID 87710560) is 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline.
What is the SMILES notation for 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline?
The canonical SMILES for 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline is CC(c1ccc(Cl)cc1)(c1nc(Cl)c2c(C(C)(c3ccc(Cl)cc3)N3CCNCC3)cccc2n1)N1CCNCC1.
What is the InChIKey of 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline?
The InChIKey is AJSXVEDTTGRNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H35Cl3N6/c1-31(40-18-14-36-15-19-40,22-6-10-24(33)11-7-22)26-4-3-5-27-28(26)29(35)39-30(38-27)32(2,41-20-16-37-17-21-41)23-8-12-25(34)13-9-23/h3-13,36-37H,14-21H2,1-2H3.
What are the key properties of 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline?
4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline has a molecular weight of 610.03 g/mol, XLogP of 5.93, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,5-bis[1-(4-chlorophenyl)-1-piperazin-1-ylethyl]quinazoline is sourced from PubChem (CID 87710560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).