C16H24ClN3S — CID 8771058
1-(4-chlorophenyl)-3-[[1-(dimethylamino)cyclohexyl]methyl]thiourea (PubChem CID 8771058) has the molecular formula C16H24ClN3S and a molecular weight of 325.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[1-(dimethylamino)cyclohexyl]methyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[1-(dimethylamino)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 8771058 |
| Molecular Formula | C16H24ClN3S |
| Molecular Weight | 325.91 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[1-(dimethylamino)cyclohexyl]methyl]thiourea |
| SMILES | CN(C)C1(CNC(=S)Nc2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C16H24ClN3S/c1-20(2)16(10-4-3-5-11-16)12-18-15(21)19-14-8-6-13(17)7-9-14/h6-9H,3-5,10-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | DOYIDELLYHLDKH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.91 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|