C18H15F7N2O2 — CID 87710756
1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]cyclohexa-3,5-diene-1,2-dicarboxamide (PubChem CID 87710756) has the molecular formula C18H15F7N2O2 and a molecular weight of 424.32 g/mol. Its IUPAC name is 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]cyclohexa-3,5-diene-1,2-dicarboxamide.
| Compound Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]cyclohexa-3,5-diene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87710756 |
| Molecular Formula | C18H15F7N2O2 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]cyclohexa-3,5-diene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1C1(C(N)=O)C=CC=CC1C(N)=O |
| InChI | InChI=1S/C18H15F7N2O2/c1-9-8-10(16(19,17(20,21)22)18(23,24)25)5-6-11(9)15(14(27)29)7-3-2-4-12(15)13(26)28/h2-8,12H,1H3,(H2,26,28)(H2,27,29) |
| InChIKey | QLQYCUJUGDTGGU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |