C10H19NO — CID 87710964
2-methyl-1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium (PubChem CID 87710964) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-methyl-1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium.
| Compound Name | 2-methyl-1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
|---|---|
| PubChem CID | 87710964 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-methyl-1-oxido-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
| SMILES | CC1CCC2CCCCC2[NH+]1[O-] |
| InChI | InChI=1S/C10H19NO/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h8-11H,2-7H2,1H3 |
| InChIKey | QKNQXDAERDITKA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |