About N-nonylsulfonylacetamide
N-nonylsulfonylacetamide (PubChem CID 87711188) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N-nonylsulfonylacetamide.
Molecular Properties
| Compound Name | N-nonylsulfonylacetamide |
| PubChem CID | 87711188 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-nonylsulfonylacetamide |
| SMILES | CCCCCCCCCS(=O)(=O)NC(C)=O |
| InChI | InChI=1S/C11H23NO3S/c1-3-4-5-6-7-8-9-10-16(14,15)12-11(2)13/h3-10H2,1-2H3,(H,12,13) |
| InChIKey | RJSICWVUNHXWAF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-nonylsulfonylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nonylsulfonylacetamide?
The IUPAC name of N-nonylsulfonylacetamide (CID 87711188) is N-nonylsulfonylacetamide.
What is the SMILES notation for N-nonylsulfonylacetamide?
The canonical SMILES for N-nonylsulfonylacetamide is CCCCCCCCCS(=O)(=O)NC(C)=O.
What is the InChIKey of N-nonylsulfonylacetamide?
The InChIKey is RJSICWVUNHXWAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3S/c1-3-4-5-6-7-8-9-10-16(14,15)12-11(2)13/h3-10H2,1-2H3,(H,12,13).
What are the key properties of N-nonylsulfonylacetamide?
N-nonylsulfonylacetamide has a molecular weight of 249.38 g/mol, XLogP of 2.20, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-nonylsulfonylacetamide is sourced from PubChem (CID 87711188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).